+86 531 68657995
| 4-(Chloromethyl)benzoic acid Basic information | |
| Product Name: | 4-(Chloromethyl)benzoic acid |
| CAS: | 1642-81-5 |
| MF: | C8H7ClO2 |
| MW: | 170.59 |
| EINECS: | 216-697-1 |
| Mol File: | 1642-81-5.mol |
| 4-(Chloromethyl)benzoic acid Chemical Properties | |
| Melting point | 201-202 °C(lit.) |
| Boiling point | 201-203 °C |
| density | 1.315±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 4.11±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to slightly yellow |
| Sensitive | Moisture Sensitive |
| BRN | 1907970 |
| InChI | InChI=1S/C8H7ClO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | OITNBJHJJGMFBN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(CCl)C=C1 |
| CAS DataBase Reference | 1642-81-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-(Chloromethyl)benzoic acid(1642-81-5) |
Application:
Dye intermediate
Pharmaceutical intermediates
Safety profile:
It is also safe for the environment. Depending on its source, it may be regarded as a vegetarian or it may not.
Storage requirements:
keep the product dry
relative humidity < 50%
protect product against influences of weather and contamination
Transport & Packaging:
It is the only packaging available in different sizes. It can be packaged in various specifications: 25kg drums, 1000kg IBC drums
